C16H22N4O5 — CID 70354836
(3S)-3-amino-4-[[(2S)-1-[amino(benzoyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 70354836) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is (3S)-3-amino-4-[[(2S)-1-[amino(benzoyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[(2S)-1-[amino(benzoyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70354836 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-1-[amino(benzoyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N(N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22N4O5/c1-9(2)13(19-14(23)11(17)8-12(21)22)16(25)20(18)15(24)10-6-4-3-5-7-10/h3-7,9,11,13H,8,17-18H2,1-2H3,(H,19,23)(H,21,22)/t11-,13-/m0/s1 |
| InChIKey | BSHMWMIVGIVRPW-AAEUAGOBSA-N |
| XLogP | -0.53 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|