C25H38O6 — CID 70356011
[(5S,8S,9S,10S,13S,14S,17S)-1-acetyloxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 70356011) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is [(5S,8S,9S,10S,13S,14S,17S)-1-acetyloxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(5S,8S,9S,10S,13S,14S,17S)-1-acetyloxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 70356011 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [(5S,8S,9S,10S,13S,14S,17S)-1-acetyloxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CC(=O)OC1(OC(C)=O)CCC[C@H]2CC[C@H]3[C@@H]4CC[C@H](C(=O)CO)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C25H38O6/c1-15(27)30-25(31-16(2)28)12-5-6-17-7-8-18-19-9-10-21(22(29)14-26)23(19,3)13-11-20(18)24(17,25)4/h17-21,26H,5-14H2,1-4H3/t17-,18-,19-,20-,21+,23-,24-/m0/s1 |
| InChIKey | AZWBNSYUOOILMO-OHOJESAGSA-N |
| XLogP | 4.03 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|