C21H34O4 — CID 67601560
methyl (5S,8S,9S,10S,13S,14S,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 67601560) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl (5S,8S,9S,10S,13S,14S,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (5S,8S,9S,10S,13S,14S,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 67601560 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl (5S,8S,9S,10S,13S,14S,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC(O)(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H34O4/c1-19-12-10-16-14(15(19)8-9-17(19)18(22)25-3)7-6-13-5-4-11-21(23,24)20(13,16)2/h13-17,23-24H,4-12H2,1-3H3/t13-,14-,15-,16-,17+,19-,20-/m0/s1 |
| InChIKey | ZHOVQCWDEWLHNV-WQBJWTDHSA-N |
| XLogP | 3.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|