C25H40O6 — CID 70566821
2-[(2R)-2-[(8S,9S,10S,13R,14S,17R)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioic acid (PubChem CID 70566821) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is 2-[(2R)-2-[(8S,9S,10S,13R,14S,17R)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioic acid.
| Compound Name | 2-[(2R)-2-[(8S,9S,10S,13R,14S,17R)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioic acid |
|---|---|
| PubChem CID | 70566821 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2-[(2R)-2-[(8S,9S,10S,13R,14S,17R)-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioic acid |
| SMILES | C[C@H](CC(C(=O)O)C(=O)O)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC(O)(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H40O6/c1-14(13-17(21(26)27)22(28)29)18-8-9-19-16-7-6-15-5-4-11-25(30,31)24(15,3)20(16)10-12-23(18,19)2/h14-20,30-31H,4-13H2,1-3H3,(H,26,27)(H,28,29)/t14-,15?,16+,18-,19+,20+,23-,24+/m1/s1 |
| InChIKey | YXJBTXPGGGUUPO-FCFKHZQQSA-N |
| XLogP | 4.14 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|