C13H18N2O4 — CID 70356732
2-(3,4-diamino-5-methylphenyl)hexanedioic acid (PubChem CID 70356732) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(3,4-diamino-5-methylphenyl)hexanedioic acid.
| Compound Name | 2-(3,4-diamino-5-methylphenyl)hexanedioic acid |
|---|---|
| PubChem CID | 70356732 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(3,4-diamino-5-methylphenyl)hexanedioic acid |
| SMILES | Cc1cc(C(CCCC(=O)O)C(=O)O)cc(N)c1N |
| InChI | InChI=1S/C13H18N2O4/c1-7-5-8(6-10(14)12(7)15)9(13(18)19)3-2-4-11(16)17/h5-6,9H,2-4,14-15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | CTYQGNFWRFJMQM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|