C15H19NO5 — CID 70358131
3-amino-3-ethoxycarbonyl-2-methyl-5-oxo-5-phenylpentanoic acid (PubChem CID 70358131) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-amino-3-ethoxycarbonyl-2-methyl-5-oxo-5-phenylpentanoic acid.
| Compound Name | 3-amino-3-ethoxycarbonyl-2-methyl-5-oxo-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 70358131 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-amino-3-ethoxycarbonyl-2-methyl-5-oxo-5-phenylpentanoic acid |
| SMILES | CCOC(=O)C(N)(CC(=O)c1ccccc1)C(C)C(=O)O |
| InChI | InChI=1S/C15H19NO5/c1-3-21-14(20)15(16,10(2)13(18)19)9-12(17)11-7-5-4-6-8-11/h4-8,10H,3,9,16H2,1-2H3,(H,18,19) |
| InChIKey | JIBMMFWCCSTHIQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |