C22H25N3O6 — CID 70358851
(Z)-2-[5-[(2-butoxyphenyl)carbamoyl]-4,5,6,7-tetrahydrobenzimidazol-1-yl]but-2-enedioic acid (PubChem CID 70358851) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is (Z)-2-[5-[(2-butoxyphenyl)carbamoyl]-4,5,6,7-tetrahydrobenzimidazol-1-yl]but-2-enedioic acid.
| Compound Name | (Z)-2-[5-[(2-butoxyphenyl)carbamoyl]-4,5,6,7-tetrahydrobenzimidazol-1-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 70358851 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (Z)-2-[5-[(2-butoxyphenyl)carbamoyl]-4,5,6,7-tetrahydrobenzimidazol-1-yl]but-2-enedioic acid |
| SMILES | CCCCOc1ccccc1NC(=O)C1CCc2c(ncn2/C(=C\C(=O)O)C(=O)O)C1 |
| InChI | InChI=1S/C22H25N3O6/c1-2-3-10-31-19-7-5-4-6-15(19)24-21(28)14-8-9-17-16(11-14)23-13-25(17)18(22(29)30)12-20(26)27/h4-7,12-14H,2-3,8-11H2,1H3,(H,24,28)(H,26,27)(H,29,30)/b18-12- |
| InChIKey | YHDPIPIWIIUAJL-PDGQHHTCSA-N |
| XLogP | 2.82 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|