C19H30N2O7S — CID 70360575
but-2-enedioic acid;N-[2-[4-[2-(dimethylamino)ethoxy]phenyl]sulfonylethyl]propan-2-amine (PubChem CID 70360575) has the molecular formula C19H30N2O7S and a molecular weight of 430.52 g/mol. Its IUPAC name is but-2-enedioic acid;N-[2-[4-[2-(dimethylamino)ethoxy]phenyl]sulfonylethyl]propan-2-amine.
| Compound Name | but-2-enedioic acid;N-[2-[4-[2-(dimethylamino)ethoxy]phenyl]sulfonylethyl]propan-2-amine |
|---|---|
| PubChem CID | 70360575 |
| Molecular Formula | C19H30N2O7S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | but-2-enedioic acid;N-[2-[4-[2-(dimethylamino)ethoxy]phenyl]sulfonylethyl]propan-2-amine |
| SMILES | CC(C)NCCS(=O)(=O)c1ccc(OCCN(C)C)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H26N2O3S.C4H4O4/c1-13(2)16-9-12-21(18,19)15-7-5-14(6-8-15)20-11-10-17(3)4;5-3(6)1-2-4(7)8/h5-8,13,16H,9-12H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | IZXJHTWZZGZUBV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|