C23H37N3O8S — CID 70473753
(Z)-but-2-enedioic acid;3-[2-(diethylamino)ethyl]-1-[2-(4-methylsulfonylphenoxy)ethyl]-1-propan-2-ylurea (PubChem CID 70473753) has the molecular formula C23H37N3O8S and a molecular weight of 515.63 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-[2-(diethylamino)ethyl]-1-[2-(4-methylsulfonylphenoxy)ethyl]-1-propan-2-ylurea.
| Compound Name | (Z)-but-2-enedioic acid;3-[2-(diethylamino)ethyl]-1-[2-(4-methylsulfonylphenoxy)ethyl]-1-propan-2-ylurea |
|---|---|
| PubChem CID | 70473753 |
| Molecular Formula | C23H37N3O8S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-[2-(diethylamino)ethyl]-1-[2-(4-methylsulfonylphenoxy)ethyl]-1-propan-2-ylurea |
| SMILES | CCN(CC)CCNC(=O)N(CCOc1ccc(S(C)(=O)=O)cc1)C(C)C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H33N3O4S.C4H4O4/c1-6-21(7-2)13-12-20-19(23)22(16(3)4)14-15-26-17-8-10-18(11-9-17)27(5,24)25;5-3(6)1-2-4(7)8/h8-11,16H,6-7,12-15H2,1-5H3,(H,20,23);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RKMWXPQHVSZPCO-BTJKTKAUSA-N |
| XLogP | 1.94 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|