C25H28N4O6 — CID 70362709
(2S)-3-(1-hydroxyimidazol-4-yl)-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]propanoic acid (PubChem CID 70362709) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is (2S)-3-(1-hydroxyimidazol-4-yl)-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(1-hydroxyimidazol-4-yl)-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70362709 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (2S)-3-(1-hydroxyimidazol-4-yl)-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1cn(O)cn1)C(=O)O)C(CC(=O)N1CCOCC1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C25H28N4O6/c30-23(28-8-10-35-11-9-28)13-19(12-18-6-3-5-17-4-1-2-7-21(17)18)24(31)27-22(25(32)33)14-20-15-29(34)16-26-20/h1-7,15-16,19,22,34H,8-14H2,(H,27,31)(H,32,33)/t19?,22-/m0/s1 |
| InChIKey | GGBXSFLZBJPQEG-BPARTEKVSA-N |
| XLogP | 1.49 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|