C32H46N4O7 — CID 70052295
(2S)-3-[[6-amino-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]hexanoyl]amino]-2-hydroxy-5-methylhexanoic acid (PubChem CID 70052295) has the molecular formula C32H46N4O7 and a molecular weight of 598.74 g/mol. Its IUPAC name is (2S)-3-[[6-amino-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]hexanoyl]amino]-2-hydroxy-5-methylhexanoic acid.
| Compound Name | (2S)-3-[[6-amino-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]hexanoyl]amino]-2-hydroxy-5-methylhexanoic acid |
|---|---|
| PubChem CID | 70052295 |
| Molecular Formula | C32H46N4O7 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | (2S)-3-[[6-amino-2-[[4-morpholin-4-yl-2-(naphthalen-1-ylmethyl)-4-oxobutanoyl]amino]hexanoyl]amino]-2-hydroxy-5-methylhexanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(CC(=O)N1CCOCC1)Cc1cccc2ccccc12)[C@H](O)C(=O)O |
| InChI | InChI=1S/C32H46N4O7/c1-21(2)18-27(29(38)32(41)42)35-31(40)26(12-5-6-13-33)34-30(39)24(20-28(37)36-14-16-43-17-15-36)19-23-10-7-9-22-8-3-4-11-25(22)23/h3-4,7-11,21,24,26-27,29,38H,5-6,12-20,33H2,1-2H3,(H,34,39)(H,35,40)(H,41,42)/t24?,26?,27?,29-/m0/s1 |
| InChIKey | QZGWAZGAKPXOMN-ROXPMHNTSA-N |
| XLogP | 1.84 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|