C20H23NO4 — CID 70367122
4-[1-hydroxy-2-[4-(4-hydroxyphenyl)piperidin-1-yl]ethyl]benzoic acid (PubChem CID 70367122) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[4-(4-hydroxyphenyl)piperidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[1-hydroxy-2-[4-(4-hydroxyphenyl)piperidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70367122 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-[1-hydroxy-2-[4-(4-hydroxyphenyl)piperidin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(O)CN2CCC(c3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23NO4/c22-18-7-5-14(6-8-18)15-9-11-21(12-10-15)13-19(23)16-1-3-17(4-2-16)20(24)25/h1-8,15,19,22-23H,9-13H2,(H,24,25) |
| InChIKey | MTMWOUCOVJBKCA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |