C31H49NOSn — CID 19696304
2-(4-phenylpiperidin-1-yl)-1-(4-tributylstannylphenyl)ethanol (PubChem CID 19696304) has the molecular formula C31H49NOSn and a molecular weight of 570.45 g/mol. Its IUPAC name is 2-(4-phenylpiperidin-1-yl)-1-(4-tributylstannylphenyl)ethanol.
| Compound Name | 2-(4-phenylpiperidin-1-yl)-1-(4-tributylstannylphenyl)ethanol |
|---|---|
| PubChem CID | 19696304 |
| Molecular Formula | C31H49NOSn |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 2-(4-phenylpiperidin-1-yl)-1-(4-tributylstannylphenyl)ethanol |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C(O)CN2CCC(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H22NO.3C4H9.Sn/c21-19(18-9-5-2-6-10-18)15-20-13-11-17(12-14-20)16-7-3-1-4-8-16;3*1-3-4-2;/h1,3-10,17,19,21H,11-15H2;3*1,3-4H2,2H3; |
| InChIKey | YGGSSARTWDTGDO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |