C32H51NOSn — CID 67828718
1-(4-phenylpiperidin-1-yl)-1-(3-tributylstannylphenyl)propan-2-ol (PubChem CID 67828718) has the molecular formula C32H51NOSn and a molecular weight of 584.48 g/mol. Its IUPAC name is 1-(4-phenylpiperidin-1-yl)-1-(3-tributylstannylphenyl)propan-2-ol.
| Compound Name | 1-(4-phenylpiperidin-1-yl)-1-(3-tributylstannylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 67828718 |
| Molecular Formula | C32H51NOSn |
| Molecular Weight | 584.48 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 1-(4-phenylpiperidin-1-yl)-1-(3-tributylstannylphenyl)propan-2-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(C(C(C)O)N2CCC(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H24NO.3C4H9.Sn/c1-16(22)20(19-10-6-3-7-11-19)21-14-12-18(13-15-21)17-8-4-2-5-9-17;3*1-3-4-2;/h2-6,8-11,16,18,20,22H,12-15H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | YSJSJODQPHLLCN-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.48 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |