C24H35F2N3O5 — CID 70369964
tert-butyl N-(1-amino-2,2-difluoro-6-methyl-3-oxoheptan-4-yl)-N-[3-(benzylamino)-2-methyl-3-oxopropanoyl]carbamate (PubChem CID 70369964) has the molecular formula C24H35F2N3O5 and a molecular weight of 483.56 g/mol. Its IUPAC name is tert-butyl N-(1-amino-2,2-difluoro-6-methyl-3-oxoheptan-4-yl)-N-[3-(benzylamino)-2-methyl-3-oxopropanoyl]carbamate.
| Compound Name | tert-butyl N-(1-amino-2,2-difluoro-6-methyl-3-oxoheptan-4-yl)-N-[3-(benzylamino)-2-methyl-3-oxopropanoyl]carbamate |
|---|---|
| PubChem CID | 70369964 |
| Molecular Formula | C24H35F2N3O5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | tert-butyl N-(1-amino-2,2-difluoro-6-methyl-3-oxoheptan-4-yl)-N-[3-(benzylamino)-2-methyl-3-oxopropanoyl]carbamate |
| SMILES | CC(C)CC(C(=O)C(F)(F)CN)N(C(=O)OC(C)(C)C)C(=O)C(C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H35F2N3O5/c1-15(2)12-18(19(30)24(25,26)14-27)29(22(33)34-23(4,5)6)21(32)16(3)20(31)28-13-17-10-8-7-9-11-17/h7-11,15-16,18H,12-14,27H2,1-6H3,(H,28,31) |
| InChIKey | VPJUSEIRXKMRHO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|