C23H28N6O4 — CID 70370075
(4S)-4-benzyl-9-butoxy-2-(2-methoxyethyl)-7-(2H-tetrazol-5-yl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 70370075) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is (4S)-4-benzyl-9-butoxy-2-(2-methoxyethyl)-7-(2H-tetrazol-5-yl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | (4S)-4-benzyl-9-butoxy-2-(2-methoxyethyl)-7-(2H-tetrazol-5-yl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 70370075 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (4S)-4-benzyl-9-butoxy-2-(2-methoxyethyl)-7-(2H-tetrazol-5-yl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | CCCCOc1c2n(cc(-c3nn[nH]n3)c1=O)[C@@H](Cc1ccccc1)CN(CCOC)C2=O |
| InChI | InChI=1S/C23H28N6O4/c1-3-4-11-33-21-19-23(31)28(10-12-32-2)14-17(13-16-8-6-5-7-9-16)29(19)15-18(20(21)30)22-24-26-27-25-22/h5-9,15,17H,3-4,10-14H2,1-2H3,(H,24,25,26,27)/t17-/m0/s1 |
| InChIKey | CIQFWCHJXYDRDK-KRWDZBQOSA-N |
| XLogP | 2.09 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|