C25H30N2O5 — CID 134384793
(4S)-7-hydroxy-2-(2-methoxyethyl)-4-[(2E,4Z)-2-methylhexa-2,4-dienyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 134384793) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is (4S)-7-hydroxy-2-(2-methoxyethyl)-4-[(2E,4Z)-2-methylhexa-2,4-dienyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | (4S)-7-hydroxy-2-(2-methoxyethyl)-4-[(2E,4Z)-2-methylhexa-2,4-dienyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 134384793 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (4S)-7-hydroxy-2-(2-methoxyethyl)-4-[(2E,4Z)-2-methylhexa-2,4-dienyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | C/C=C\C=C(/C)C[C@H]1CN(CCOC)C(=O)c2c(OCc3ccccc3)c(=O)c(O)cn21 |
| InChI | InChI=1S/C25H30N2O5/c1-4-5-9-18(2)14-20-15-26(12-13-31-3)25(30)22-24(23(29)21(28)16-27(20)22)32-17-19-10-7-6-8-11-19/h4-11,16,20,28H,12-15,17H2,1-3H3/b5-4-,18-9+/t20-/m0/s1 |
| InChIKey | VBAWFDMWZPSWPY-BPPTZQAPSA-N |
| XLogP | 3.69 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|