C19H22NO4+ — CID 7037180
(13aR)-3,10-dimethoxy-5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,11-diol (PubChem CID 7037180) has the molecular formula C19H22NO4+ and a molecular weight of 328.39 g/mol. Its IUPAC name is (13aR)-3,10-dimethoxy-5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,11-diol.
| Compound Name | (13aR)-3,10-dimethoxy-5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,11-diol |
|---|---|
| PubChem CID | 7037180 |
| Molecular Formula | C19H22NO4+ |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (13aR)-3,10-dimethoxy-5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,11-diol |
| SMILES | COc1cc2c(cc1O)C[C@@H]1c3cc(O)c(OC)cc3CC[NH+]1C2 |
| InChI | InChI=1S/C19H21NO4/c1-23-18-7-11-3-4-20-10-13-8-19(24-2)16(21)6-12(13)5-15(20)14(11)9-17(18)22/h6-9,15,21-22H,3-5,10H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | BWUQAWCUJMATJS-OAHLLOKOSA-O |
| XLogP | 1.35 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |