C11H16O5 — CID 70372315
acetic acid;2,3-bis(hydroxymethyl)-4-methylphenol (PubChem CID 70372315) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is acetic acid;2,3-bis(hydroxymethyl)-4-methylphenol.
| Compound Name | acetic acid;2,3-bis(hydroxymethyl)-4-methylphenol |
|---|---|
| PubChem CID | 70372315 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | acetic acid;2,3-bis(hydroxymethyl)-4-methylphenol |
| SMILES | CC(=O)O.Cc1ccc(O)c(CO)c1CO |
| InChI | InChI=1S/C9H12O3.C2H4O2/c1-6-2-3-9(12)8(5-11)7(6)4-10;1-2(3)4/h2-3,10-12H,4-5H2,1H3;1H3,(H,3,4) |
| InChIKey | IWELUQTYBFBNRV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |