C10H14O5 — CID 20553274
formaldehyde;2,3,4-tris(hydroxymethyl)phenol (PubChem CID 20553274) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is formaldehyde;2,3,4-tris(hydroxymethyl)phenol.
| Compound Name | formaldehyde;2,3,4-tris(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 20553274 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | formaldehyde;2,3,4-tris(hydroxymethyl)phenol |
| SMILES | C=O.OCc1ccc(O)c(CO)c1CO |
| InChI | InChI=1S/C9H12O4.CH2O/c10-3-6-1-2-9(13)8(5-12)7(6)4-11;1-2/h1-2,10-13H,3-5H2;1H2 |
| InChIKey | VTAAYRUXVDARRC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |