C10H14O5 — CID 163585989
2,3,4,6-tetrakis(hydroxymethyl)phenol (PubChem CID 163585989) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2,3,4,6-tetrakis(hydroxymethyl)phenol.
| Compound Name | 2,3,4,6-tetrakis(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 163585989 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2,3,4,6-tetrakis(hydroxymethyl)phenol |
| SMILES | OCc1cc(CO)c(CO)c(CO)c1O |
| InChI | InChI=1S/C10H14O5/c11-2-6-1-7(3-12)10(15)9(5-14)8(6)4-13/h1,11-15H,2-5H2 |
| InChIKey | GLNCVFLSARSALP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |