C29H31F2NO4 — CID 70373548
methyl 4-[3-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]propoxy]benzoate (PubChem CID 70373548) has the molecular formula C29H31F2NO4 and a molecular weight of 495.57 g/mol. Its IUPAC name is methyl 4-[3-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]propoxy]benzoate.
| Compound Name | methyl 4-[3-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 70373548 |
| Molecular Formula | C29H31F2NO4 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | methyl 4-[3-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCN2CCC(CO)CC2(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H31F2NO4/c1-35-28(34)22-3-13-27(14-4-22)36-18-2-16-32-17-15-21(20-33)19-29(32,23-5-9-25(30)10-6-23)24-7-11-26(31)12-8-24/h3-14,21,33H,2,15-20H2,1H3 |
| InChIKey | LMKWFBIBLQEGRE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|