C13H17BrN2O4 — CID 70374026
tert-butyl 3-(5-bromo-6-oxo-1H-pyridin-3-yl)-2-(methylamino)-3-oxopropanoate (PubChem CID 70374026) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is tert-butyl 3-(5-bromo-6-oxo-1H-pyridin-3-yl)-2-(methylamino)-3-oxopropanoate.
| Compound Name | tert-butyl 3-(5-bromo-6-oxo-1H-pyridin-3-yl)-2-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 70374026 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | tert-butyl 3-(5-bromo-6-oxo-1H-pyridin-3-yl)-2-(methylamino)-3-oxopropanoate |
| SMILES | CNC(C(=O)OC(C)(C)C)C(=O)c1c[nH]c(=O)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O4/c1-13(2,3)20-12(19)9(15-4)10(17)7-5-8(14)11(18)16-6-7/h5-6,9,15H,1-4H3,(H,16,18) |
| InChIKey | UIDWAXCAXOFIHP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|