C18H28N2O6 — CID 70375561
(2S)-2-(diethylamino)-3-[[4-(2-methoxyethoxymethoxy)benzoyl]amino]propanoic acid (PubChem CID 70375561) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2S)-2-(diethylamino)-3-[[4-(2-methoxyethoxymethoxy)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-(diethylamino)-3-[[4-(2-methoxyethoxymethoxy)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70375561 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (2S)-2-(diethylamino)-3-[[4-(2-methoxyethoxymethoxy)benzoyl]amino]propanoic acid |
| SMILES | CCN(CC)[C@@H](CNC(=O)c1ccc(OCOCCOC)cc1)C(=O)O |
| InChI | InChI=1S/C18H28N2O6/c1-4-20(5-2)16(18(22)23)12-19-17(21)14-6-8-15(9-7-14)26-13-25-11-10-24-3/h6-9,16H,4-5,10-13H2,1-3H3,(H,19,21)(H,22,23)/t16-/m0/s1 |
| InChIKey | CLQGHYBCNMDEJW-INIZCTEOSA-N |
| XLogP | 1.21 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|