C23H33BrO4 — CID 70376616
(5'R,8'S,9'S,10'S,13'S,14'S,17'S)-10'-(3-bromoprop-2-ynyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol (PubChem CID 70376616) has the molecular formula C23H33BrO4 and a molecular weight of 453.42 g/mol. Its IUPAC name is (5'R,8'S,9'S,10'S,13'S,14'S,17'S)-10'-(3-bromoprop-2-ynyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol.
| Compound Name | (5'R,8'S,9'S,10'S,13'S,14'S,17'S)-10'-(3-bromoprop-2-ynyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
|---|---|
| PubChem CID | 70376616 |
| Molecular Formula | C23H33BrO4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (5'R,8'S,9'S,10'S,13'S,14'S,17'S)-10'-(3-bromoprop-2-ynyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@]4(O)CC5(CC[C@]34CC#CBr)OCCO5)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C23H33BrO4/c1-20-8-6-18-16(17(20)3-4-19(20)25)5-9-22(26)15-23(27-13-14-28-23)11-10-21(18,22)7-2-12-24/h16-19,25-26H,3-11,13-15H2,1H3/t16-,17-,18-,19-,20-,21+,22+/m0/s1 |
| InChIKey | GSRLQHQCYQXRFL-FIPIOZDTSA-N |
| XLogP | 3.97 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|