C34H56O5Si — CID 11093016
CID 11093016 (PubChem CID 11093016) has the molecular formula C34H56O5Si and a molecular weight of 572.90 g/mol.
| Compound Name | CID 11093016 |
|---|---|
| PubChem CID | 11093016 |
| Molecular Formula | C34H56O5Si |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | — |
| SMILES | CC1(C)COC2(CC[C@]3(CC#C[Si](C)(C)C)[C@H]4CC[C@@]5(C)[C@@H](CCC56OCC(C)(C)CO6)[C@@H]4CC[C@@]3(O)C2)OC1 |
| InChI | InChI=1S/C34H56O5Si/c1-28(2)21-36-33(37-22-28)18-17-31(13-9-19-40(6,7)8)27-11-14-30(5)26(25(27)10-15-32(31,35)20-33)12-16-34(30)38-23-29(3,4)24-39-34/h25-27,35H,10-18,20-24H2,1-8H3/t25-,26-,27-,30-,31+,32+/m0/s1 |
| InChIKey | NAISPCAPUXSKBA-IOEOTGLTSA-N |
| XLogP | 6.93 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|