C35H48O4Si — CID 22842749
(1'S,11'S,15'S,16'S,19'R)-19'-hydroxy-5,5,11'-trimethyl-5'-(2-trimethylsilylethynyl)spiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6-triene]-12'-one (PubChem CID 22842749) has the molecular formula C35H48O4Si and a molecular weight of 560.85 g/mol. Its IUPAC name is (1'S,11'S,15'S,16'S,19'R)-19'-hydroxy-5,5,11'-trimethyl-5'-(2-trimethylsilylethynyl)spiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6-triene]-12'-one.
| Compound Name | (1'S,11'S,15'S,16'S,19'R)-19'-hydroxy-5,5,11'-trimethyl-5'-(2-trimethylsilylethynyl)spiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6-triene]-12'-one |
|---|---|
| PubChem CID | 22842749 |
| Molecular Formula | C35H48O4Si |
| Molecular Weight | 560.85 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | (1'S,11'S,15'S,16'S,19'R)-19'-hydroxy-5,5,11'-trimethyl-5'-(2-trimethylsilylethynyl)spiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6-triene]-12'-one |
| SMILES | CC1(C)COC2(CC[C@@]34Cc5cc(C#C[Si](C)(C)C)ccc5C5C[C@]6(C)C(=O)CC[C@H]6C(CC[C@@]3(O)C2)C54)OC1 |
| InChI | InChI=1S/C35H48O4Si/c1-31(2)21-38-35(39-22-31)15-14-33-18-24-17-23(12-16-40(4,5)6)7-8-25(24)27-19-32(3)28(9-10-29(32)36)26(30(27)33)11-13-34(33,37)20-35/h7-8,17,26-28,30,37H,9-11,13-15,18-22H2,1-6H3/t26?,27?,28-,30?,32-,33-,34+/m0/s1 |
| InChIKey | HBYRNGWRXPSPHV-RDISFPIYSA-N |
| XLogP | 6.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.85 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|