C32H40O4 — CID 22842739
(1'S,11'S,15'S,16'S,19'R)-4'-ethynyl-19'-hydroxy-5,5,11'-trimethylspiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3,5,7-triene]-12'-one (PubChem CID 22842739) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is (1'S,11'S,15'S,16'S,19'R)-4'-ethynyl-19'-hydroxy-5,5,11'-trimethylspiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3,5,7-triene]-12'-one.
| Compound Name | (1'S,11'S,15'S,16'S,19'R)-4'-ethynyl-19'-hydroxy-5,5,11'-trimethylspiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3,5,7-triene]-12'-one |
|---|---|
| PubChem CID | 22842739 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | (1'S,11'S,15'S,16'S,19'R)-4'-ethynyl-19'-hydroxy-5,5,11'-trimethylspiro[1,3-dioxane-2,21'-hexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3,5,7-triene]-12'-one |
| SMILES | C#Cc1cccc2c1C[C@]13CCC4(C[C@]1(O)CCC1C3C2C[C@]2(C)C(=O)CC[C@@H]12)OCC(C)(C)CO4 |
| InChI | InChI=1S/C32H40O4/c1-5-20-7-6-8-21-23(20)16-30-13-14-32(35-18-28(2,3)19-36-32)17-31(30,34)12-11-22-25-9-10-26(33)29(25,4)15-24(21)27(22)30/h1,6-8,22,24-25,27,34H,9-19H2,2-4H3/t22?,24?,25-,27?,29-,30-,31+/m0/s1 |
| InChIKey | MFSDHMQLTGYYIC-AMGYOJBKSA-N |
| XLogP | 5.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|