C22H23Br3O — CID 70379258
3-(4-heptylphenyl)-1-(2,4,6-tribromophenyl)prop-2-en-1-one (PubChem CID 70379258) has the molecular formula C22H23Br3O and a molecular weight of 543.14 g/mol. Its IUPAC name is 3-(4-heptylphenyl)-1-(2,4,6-tribromophenyl)prop-2-en-1-one.
| Compound Name | 3-(4-heptylphenyl)-1-(2,4,6-tribromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70379258 |
| Molecular Formula | C22H23Br3O |
| Molecular Weight | 543.14 g/mol |
| Exact Mass | 539.93 |
| IUPAC Name | 3-(4-heptylphenyl)-1-(2,4,6-tribromophenyl)prop-2-en-1-one |
| SMILES | CCCCCCCc1ccc(C=CC(=O)c2c(Br)cc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C22H23Br3O/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)12-13-21(26)22-19(24)14-18(23)15-20(22)25/h8-15H,2-7H2,1H3 |
| InChIKey | XINYWRDCUMQVQF-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.14 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|