C25H32O3 — CID 88620506
(E)-3-(4-decylphenyl)-1-(2,6-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 88620506) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (E)-3-(4-decylphenyl)-1-(2,6-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-decylphenyl)-1-(2,6-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 88620506 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (E)-3-(4-decylphenyl)-1-(2,6-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCCCCCc1ccc(/C=C/C(=O)c2c(O)cccc2O)cc1 |
| InChI | InChI=1S/C25H32O3/c1-2-3-4-5-6-7-8-9-11-20-14-16-21(17-15-20)18-19-24(28)25-22(26)12-10-13-23(25)27/h10,12-19,26-27H,2-9,11H2,1H3/b19-18+ |
| InChIKey | BTIMXIUNOGKLCM-VHEBQXMUSA-N |
| XLogP | 6.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|