C17H26ClFIN3O2 — CID 70381815
N-ethyl-4-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-iodopiperazine-1-carboxamide;hydrochloride (PubChem CID 70381815) has the molecular formula C17H26ClFIN3O2 and a molecular weight of 485.77 g/mol. Its IUPAC name is N-ethyl-4-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-iodopiperazine-1-carboxamide;hydrochloride.
| Compound Name | N-ethyl-4-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-iodopiperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70381815 |
| Molecular Formula | C17H26ClFIN3O2 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | N-ethyl-4-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-iodopiperazine-1-carboxamide;hydrochloride |
| SMILES | CCNC(=O)N1CCN(CCCC(O)c2ccc(F)cc2)CC1I.Cl |
| InChI | InChI=1S/C17H25FIN3O2.ClH/c1-2-20-17(24)22-11-10-21(12-16(22)19)9-3-4-15(23)13-5-7-14(18)8-6-13;/h5-8,15-16,23H,2-4,9-12H2,1H3,(H,20,24);1H |
| InChIKey | OUKQGLZQZHCYGP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|