C9H17N3OSi — CID 70382355
trimethyl-[1-(1,2,4-triazol-1-yl)but-1-en-2-yloxy]silane (PubChem CID 70382355) has the molecular formula C9H17N3OSi and a molecular weight of 211.34 g/mol. Its IUPAC name is trimethyl-[1-(1,2,4-triazol-1-yl)but-1-en-2-yloxy]silane.
| Compound Name | trimethyl-[1-(1,2,4-triazol-1-yl)but-1-en-2-yloxy]silane |
|---|---|
| PubChem CID | 70382355 |
| Molecular Formula | C9H17N3OSi |
| Molecular Weight | 211.34 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | trimethyl-[1-(1,2,4-triazol-1-yl)but-1-en-2-yloxy]silane |
| SMILES | CCC(=Cn1cncn1)O[Si](C)(C)C |
| InChI | InChI=1S/C9H17N3OSi/c1-5-9(13-14(2,3)4)6-12-8-10-7-11-12/h6-8H,5H2,1-4H3 |
| InChIKey | JVZSQWMBUICAAH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|