C20H19ClFNO2 — CID 70382660
4-[4-[(4-chlorophenyl)methyl]-5-fluoro-3-methyl-1H-indol-2-yl]butanoic acid (PubChem CID 70382660) has the molecular formula C20H19ClFNO2 and a molecular weight of 359.83 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methyl]-5-fluoro-3-methyl-1H-indol-2-yl]butanoic acid.
| Compound Name | 4-[4-[(4-chlorophenyl)methyl]-5-fluoro-3-methyl-1H-indol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 70382660 |
| Molecular Formula | C20H19ClFNO2 |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methyl]-5-fluoro-3-methyl-1H-indol-2-yl]butanoic acid |
| SMILES | Cc1c(CCCC(=O)O)[nH]c2ccc(F)c(Cc3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C20H19ClFNO2/c1-12-17(3-2-4-19(24)25)23-18-10-9-16(22)15(20(12)18)11-13-5-7-14(21)8-6-13/h5-10,23H,2-4,11H2,1H3,(H,24,25) |
| InChIKey | NIONCOLBZVNQIE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |