C21H27Cl2N5O2 — CID 70383566
11-[2-[2-(1-methylpyrrolidin-2-yl)ethylamino]acetyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one;dihydrochloride (PubChem CID 70383566) has the molecular formula C21H27Cl2N5O2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 11-[2-[2-(1-methylpyrrolidin-2-yl)ethylamino]acetyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one;dihydrochloride.
| Compound Name | 11-[2-[2-(1-methylpyrrolidin-2-yl)ethylamino]acetyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one;dihydrochloride |
|---|---|
| PubChem CID | 70383566 |
| Molecular Formula | C21H27Cl2N5O2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 11-[2-[2-(1-methylpyrrolidin-2-yl)ethylamino]acetyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one;dihydrochloride |
| SMILES | CN1CCCC1CCNCC(=O)N1c2ccccc2NC(=O)c2cccnc21.Cl.Cl |
| InChI | InChI=1S/C21H25N5O2.2ClH/c1-25-13-5-6-15(25)10-12-22-14-19(27)26-18-9-3-2-8-17(18)24-21(28)16-7-4-11-23-20(16)26;;/h2-4,7-9,11,15,22H,5-6,10,12-14H2,1H3,(H,24,28);2*1H |
| InChIKey | JFAQBYYPMLJJFA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|