C24H30N4O2 — CID 70384038
11-[6-(azepan-2-yl)hexanoyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one (PubChem CID 70384038) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 11-[6-(azepan-2-yl)hexanoyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one.
| Compound Name | 11-[6-(azepan-2-yl)hexanoyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one |
|---|---|
| PubChem CID | 70384038 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 11-[6-(azepan-2-yl)hexanoyl]-6H-pyrido[3,2-c][1,5]benzodiazepin-5-one |
| SMILES | O=C1Nc2ccccc2N(C(=O)CCCCCC2CCCCCN2)c2ncccc21 |
| InChI | InChI=1S/C24H30N4O2/c29-22(15-5-1-3-10-18-11-4-2-8-16-25-18)28-21-14-7-6-13-20(21)27-24(30)19-12-9-17-26-23(19)28/h6-7,9,12-14,17-18,25H,1-5,8,10-11,15-16H2,(H,27,30) |
| InChIKey | YYESMEWOTACLLY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|