About 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one
11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 70384680) has the molecular formula C16H14BrN3O2
and a molecular weight of 360.21 g/mol. Its IUPAC name is 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
Molecular Properties
| Compound Name | 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| PubChem CID | 70384680 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2cccnc2N(C(=O)CCCBr)c2ccccc21 |
| InChI | InChI=1S/C16H14BrN3O2/c17-9-3-8-14(21)20-13-7-2-1-5-11(13)16(22)19-12-6-4-10-18-15(12)20/h1-2,4-7,10H,3,8-9H2,(H,19,22) |
| InChIKey | VLVHVUBLQAPXFL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one?
The IUPAC name of 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (CID 70384680) is 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
What is the SMILES notation for 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one?
The canonical SMILES for 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one is O=C1Nc2cccnc2N(C(=O)CCCBr)c2ccccc21.
What is the InChIKey of 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one?
The InChIKey is VLVHVUBLQAPXFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrN3O2/c17-9-3-8-14(21)20-13-7-2-1-5-11(13)16(22)19-12-6-4-10-18-15(12)20/h1-2,4-7,10H,3,8-9H2,(H,19,22).
What are the key properties of 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one?
11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one has a molecular weight of 360.21 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(4-bromobutanoyl)-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one is sourced from PubChem (CID 70384680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).