C24H29ClN4O2 — CID 70384090
11-[6-(azepan-1-yl)hexanoyl]-9-chloro-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 70384090) has the molecular formula C24H29ClN4O2 and a molecular weight of 440.98 g/mol. Its IUPAC name is 11-[6-(azepan-1-yl)hexanoyl]-9-chloro-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-[6-(azepan-1-yl)hexanoyl]-9-chloro-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 70384090 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 11-[6-(azepan-1-yl)hexanoyl]-9-chloro-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2cccnc2N(C(=O)CCCCCN2CCCCCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H29ClN4O2/c25-18-11-12-19-21(17-18)29(23-20(27-24(19)31)9-8-13-26-23)22(30)10-4-3-7-16-28-14-5-1-2-6-15-28/h8-9,11-13,17H,1-7,10,14-16H2,(H,27,31) |
| InChIKey | LMEUHMUYVRCSNT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|