C24H38N4O7 — CID 70385432
1,1-dimethoxyethyl N-[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 70385432) has the molecular formula C24H38N4O7 and a molecular weight of 494.59 g/mol. Its IUPAC name is 1,1-dimethoxyethyl N-[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | 1,1-dimethoxyethyl N-[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70385432 |
| Molecular Formula | C24H38N4O7 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 1,1-dimethoxyethyl N-[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCC(=O)C(=O)[C@H](CC1CCCCC1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)OC(C)(OC)OC |
| InChI | InChI=1S/C24H38N4O7/c1-5-9-20(29)21(30)18(12-16-10-7-6-8-11-16)27-22(31)19(13-17-14-25-15-26-17)28-23(32)35-24(2,33-3)34-4/h14-16,18-19H,5-13H2,1-4H3,(H,25,26)(H,27,31)(H,28,32)/t18-,19-/m0/s1 |
| InChIKey | CBLAAXMTJSNAJF-OALUTQOASA-N |
| XLogP | 2.41 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|