C6H9ClN2 — CID 70386294
4-chlorocyclohexa-1,5-diene-1,4-diamine (PubChem CID 70386294) has the molecular formula C6H9ClN2 and a molecular weight of 144.60 g/mol. Its IUPAC name is 4-chlorocyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-chlorocyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 70386294 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 4-chlorocyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CCC(N)(Cl)C=C1 |
| InChI | InChI=1S/C6H9ClN2/c7-6(9)3-1-5(8)2-4-6/h1-3H,4,8-9H2 |
| InChIKey | PUCLIVLEHNNLMV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|