About 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene
3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene (PubChem CID 70388366) has the molecular formula C23H26O9
and a molecular weight of 446.45 g/mol. Its IUPAC name is 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene.
Molecular Properties
| Compound Name | 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene |
| PubChem CID | 70388366 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene |
| SMILES | CCOC(OC(=O)CC(=O)O)OC(=O)CC(=O)O.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C9H12O9/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-16-9(17-7(14)3-5(10)11)18-8(15)4-6(12)13/h1-10H,11-12H2;9H,2-4H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | FTKFGIBKTRSNJM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene?
The IUPAC name of 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene (CID 70388366) is 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene.
What is the SMILES notation for 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene?
The canonical SMILES for 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene is CCOC(OC(=O)CC(=O)O)OC(=O)CC(=O)O.c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene?
The InChIKey is FTKFGIBKTRSNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C9H12O9/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-16-9(17-7(14)3-5(10)11)18-8(15)4-6(12)13/h1-10H,11-12H2;9H,2-4H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene?
3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene has a molecular weight of 446.45 g/mol, XLogP of 2.81, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-carboxyacetyl)oxy-ethoxymethoxy]-3-oxopropanoic acid;2-phenylethylbenzene is sourced from PubChem (CID 70388366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).