C25H31NO2S — CID 70389092
[(1R)-1-cyanoethyl] 4-(4-nonylsulfanylphenyl)benzoate (PubChem CID 70389092) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 4-(4-nonylsulfanylphenyl)benzoate.
| Compound Name | [(1R)-1-cyanoethyl] 4-(4-nonylsulfanylphenyl)benzoate |
|---|---|
| PubChem CID | 70389092 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [(1R)-1-cyanoethyl] 4-(4-nonylsulfanylphenyl)benzoate |
| SMILES | CCCCCCCCCSc1ccc(-c2ccc(C(=O)O[C@H](C)C#N)cc2)cc1 |
| InChI | InChI=1S/C25H31NO2S/c1-3-4-5-6-7-8-9-18-29-24-16-14-22(15-17-24)21-10-12-23(13-11-21)25(27)28-20(2)19-26/h10-17,20H,3-9,18H2,1-2H3/t20-/m1/s1 |
| InChIKey | UAPSMRAUHZKDNY-HXUWFJFHSA-N |
| XLogP | 7.27 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|