C26H34O4S — CID 70387412
[(2S)-1-ethoxy-1-oxopropan-2-yl] 4-(4-octylsulfanylphenyl)benzoate (PubChem CID 70387412) has the molecular formula C26H34O4S and a molecular weight of 442.62 g/mol. Its IUPAC name is [(2S)-1-ethoxy-1-oxopropan-2-yl] 4-(4-octylsulfanylphenyl)benzoate.
| Compound Name | [(2S)-1-ethoxy-1-oxopropan-2-yl] 4-(4-octylsulfanylphenyl)benzoate |
|---|---|
| PubChem CID | 70387412 |
| Molecular Formula | C26H34O4S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [(2S)-1-ethoxy-1-oxopropan-2-yl] 4-(4-octylsulfanylphenyl)benzoate |
| SMILES | CCCCCCCCSc1ccc(-c2ccc(C(=O)O[C@@H](C)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C26H34O4S/c1-4-6-7-8-9-10-19-31-24-17-15-22(16-18-24)21-11-13-23(14-12-21)26(28)30-20(3)25(27)29-5-2/h11-18,20H,4-10,19H2,1-3H3/t20-/m0/s1 |
| InChIKey | LAJCEALVDZICQG-FQEVSTJZSA-N |
| XLogP | 6.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|