C20H21BrO7 — CID 70389783
dimethyl 2-[(2S)-2-(5-bromo-6-methoxynaphthalen-2-yl)propanoyl]-3-hydroxybutanedioate (PubChem CID 70389783) has the molecular formula C20H21BrO7 and a molecular weight of 453.29 g/mol. Its IUPAC name is dimethyl 2-[(2S)-2-(5-bromo-6-methoxynaphthalen-2-yl)propanoyl]-3-hydroxybutanedioate.
| Compound Name | dimethyl 2-[(2S)-2-(5-bromo-6-methoxynaphthalen-2-yl)propanoyl]-3-hydroxybutanedioate |
|---|---|
| PubChem CID | 70389783 |
| Molecular Formula | C20H21BrO7 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | dimethyl 2-[(2S)-2-(5-bromo-6-methoxynaphthalen-2-yl)propanoyl]-3-hydroxybutanedioate |
| SMILES | COC(=O)C(O)C(C(=O)OC)C(=O)[C@@H](C)c1ccc2c(Br)c(OC)ccc2c1 |
| InChI | InChI=1S/C20H21BrO7/c1-10(17(22)15(19(24)27-3)18(23)20(25)28-4)11-5-7-13-12(9-11)6-8-14(26-2)16(13)21/h5-10,15,18,23H,1-4H3/t10-,15?,18?/m0/s1 |
| InChIKey | OIOVXPXBVBONFR-OJJOVDNXSA-N |
| XLogP | 2.61 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|