C16H26O3S — CID 70399413
(Z)-7-[(3R,4S)-4-(2-prop-1-enylsulfanylethyl)oxolan-3-yl]hept-5-enoic acid (PubChem CID 70399413) has the molecular formula C16H26O3S and a molecular weight of 298.45 g/mol. Its IUPAC name is (Z)-7-[(3R,4S)-4-(2-prop-1-enylsulfanylethyl)oxolan-3-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,4S)-4-(2-prop-1-enylsulfanylethyl)oxolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70399413 |
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (Z)-7-[(3R,4S)-4-(2-prop-1-enylsulfanylethyl)oxolan-3-yl]hept-5-enoic acid |
| SMILES | CC=CSCC[C@@H]1COC[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C16H26O3S/c1-2-10-20-11-9-15-13-19-12-14(15)7-5-3-4-6-8-16(17)18/h2-3,5,10,14-15H,4,6-9,11-13H2,1H3,(H,17,18)/b5-3-,10-2?/t14-,15+/m0/s1 |
| InChIKey | NOJSCRITCCRTPC-BUNNTYJFSA-N |
| XLogP | 4.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|