C12H20O2S — CID 10846981
ethyl 1,3,5-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate (PubChem CID 10846981) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is ethyl 1,3,5-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl 1,3,5-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10846981 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | ethyl 1,3,5-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(C)C(C)C=C(C)C1SC |
| InChI | InChI=1S/C12H20O2S/c1-6-14-11(13)12(4)9(3)7-8(2)10(12)15-5/h7,9-10H,6H2,1-5H3 |
| InChIKey | BBPLNYHZFKIMSR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|