C13H18O3S — CID 54143510
trans-ethyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate (PubChem CID 54143510) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is trans-ethyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54143510 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | trans-ethyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C=C2CCSC2=O)C1(C)C |
| InChI | InChI=1S/C13H18O3S/c1-4-16-11(14)10-9(13(10,2)3)7-8-5-6-17-12(8)15/h7,9-10H,4-6H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | OCSSLCGMMRBPJJ-UWVGGRQHSA-N |
| XLogP | 2.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|