C15H22O3S — CID 57198606
cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate (PubChem CID 57198606) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate.
| Compound Name | cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57198606 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@@H](C=C2CCSC2=O)C1(C)C |
| InChI | InChI=1S/C15H22O3S/c1-14(2,3)18-12(16)11-10(15(11,4)5)8-9-6-7-19-13(9)17/h8,10-11H,6-7H2,1-5H3/t10-,11+/m1/s1 |
| InChIKey | BINQTBCHZVVAGN-MNOVXSKESA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|