C14H22O3S — CID 57290912
trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-methylsulfanyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 57290912) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-methylsulfanyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-methylsulfanyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57290912 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-methylsulfanyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CSC(=O)C=C[C@H]1[C@@H](C(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C14H22O3S/c1-13(2,3)17-12(16)11-9(14(11,4)5)7-8-10(15)18-6/h7-9,11H,1-6H3/t9-,11-/m0/s1 |
| InChIKey | FZTMTLUNJOXFLZ-ONGXEEELSA-N |
| XLogP | 3.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|