C13H20O2S — CID 11160808
ethyl 3,4-dimethyl-6-prop-1-en-2-yl-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 11160808) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is ethyl 3,4-dimethyl-6-prop-1-en-2-yl-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | ethyl 3,4-dimethyl-6-prop-1-en-2-yl-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 11160808 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | ethyl 3,4-dimethyl-6-prop-1-en-2-yl-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | C=C(C)C1(C(=O)OCC)CC(C)=C(C)CS1 |
| InChI | InChI=1S/C13H20O2S/c1-6-15-12(14)13(9(2)3)7-10(4)11(5)8-16-13/h2,6-8H2,1,3-5H3 |
| InChIKey | FUQMGSATSXYZGL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|