C10H14O2S — CID 10608028
8,9-dimethyl-2-oxa-6-thiaspiro[4.5]dec-8-en-1-one (PubChem CID 10608028) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 8,9-dimethyl-2-oxa-6-thiaspiro[4.5]dec-8-en-1-one.
| Compound Name | 8,9-dimethyl-2-oxa-6-thiaspiro[4.5]dec-8-en-1-one |
|---|---|
| PubChem CID | 10608028 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 8,9-dimethyl-2-oxa-6-thiaspiro[4.5]dec-8-en-1-one |
| SMILES | CC1=C(C)CC2(CCOC2=O)SC1 |
| InChI | InChI=1S/C10H14O2S/c1-7-5-10(13-6-8(7)2)3-4-12-9(10)11/h3-6H2,1-2H3 |
| InChIKey | LBZDHLVHRXNBAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|